C10H18O8 — CID 89211540
3-[(2S,3R,4S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl deuterioformate (PubChem CID 89211540) has the molecular formula C10H18O8 and a molecular weight of 267.25 g/mol. Its IUPAC name is 3-[(2S,3R,4S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl deuterioformate.
| Compound Name | 3-[(2S,3R,4S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl deuterioformate |
|---|---|
| PubChem CID | 89211540 |
| Molecular Formula | C10H18O8 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 3-[(2S,3R,4S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl deuterioformate |
| SMILES | [2H]C(=O)OCCCO[C@H]1O[C@H](CO)C(O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H18O8/c11-4-6-7(13)8(14)9(15)10(18-6)17-3-1-2-16-5-12/h5-11,13-15H,1-4H2/t6-,7?,8+,9-,10+/m1/s1/i5D |
| InChIKey | WEWMCIRHFDVOIE-JTHHGKHGSA-N |
| XLogP | -2.63 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|