C11H10N2O6 — CID 89222558
3-(hydroxycarbamoyl)-5-(2-oxoethylcarbamoyl)benzoic acid (PubChem CID 89222558) has the molecular formula C11H10N2O6 and a molecular weight of 266.21 g/mol. Its IUPAC name is 3-(hydroxycarbamoyl)-5-(2-oxoethylcarbamoyl)benzoic acid.
| Compound Name | 3-(hydroxycarbamoyl)-5-(2-oxoethylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 89222558 |
| Molecular Formula | C11H10N2O6 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 3-(hydroxycarbamoyl)-5-(2-oxoethylcarbamoyl)benzoic acid |
| SMILES | O=CCNC(=O)c1cc(C(=O)O)cc(C(=O)NO)c1 |
| InChI | InChI=1S/C11H10N2O6/c14-2-1-12-9(15)6-3-7(10(16)13-19)5-8(4-6)11(17)18/h2-5,19H,1H2,(H,12,15)(H,13,16)(H,17,18) |
| InChIKey | WNZYPYCGFLUKPR-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|