C33H31F3N4O4 — CID 89229236
(6S,9aS)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-ynyl-8-[[3-(trifluoromethyl)phenyl]methyl]-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxamide (PubChem CID 89229236) has the molecular formula C33H31F3N4O4 and a molecular weight of 604.63 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-ynyl-8-[[3-(trifluoromethyl)phenyl]methyl]-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-ynyl-8-[[3-(trifluoromethyl)phenyl]methyl]-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxamide |
|---|---|
| PubChem CID | 89229236 |
| Molecular Formula | C33H31F3N4O4 |
| Molecular Weight | 604.63 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | (6S,9aS)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-ynyl-8-[[3-(trifluoromethyl)phenyl]methyl]-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxamide |
| SMILES | C#CCC1CC(=O)N2[C@H](CN(Cc3cccc(C(F)(F)F)c3)C(=O)[C@@H]2Cc2ccc(O)cc2)N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C33H31F3N4O4/c1-2-7-26-18-30(42)40-28(17-22-12-14-27(41)15-13-22)31(43)38(20-24-10-6-11-25(16-24)33(34,35)36)21-29(40)39(26)32(44)37-19-23-8-4-3-5-9-23/h1,3-6,8-16,26,28-29,41H,7,17-21H2,(H,37,44)/t26?,28-,29+/m0/s1 |
| InChIKey | OEJSIJHTPYYVSX-GXRAEGJDSA-N |
| XLogP | 4.53 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.63 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|