C25H31N3O4S2 — CID 89230431
(E)-3-[4-(dipropylsulfamoyl)phenyl]-N-[4-(4-methoxyphenyl)-4,5-dihydro-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 89230431) has the molecular formula C25H31N3O4S2 and a molecular weight of 501.67 g/mol. Its IUPAC name is (E)-3-[4-(dipropylsulfamoyl)phenyl]-N-[4-(4-methoxyphenyl)-4,5-dihydro-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-[4-(dipropylsulfamoyl)phenyl]-N-[4-(4-methoxyphenyl)-4,5-dihydro-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89230431 |
| Molecular Formula | C25H31N3O4S2 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | (E)-3-[4-(dipropylsulfamoyl)phenyl]-N-[4-(4-methoxyphenyl)-4,5-dihydro-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(/C=C/C(=O)NC2=NC(c3ccc(OC)cc3)CS2)cc1 |
| InChI | InChI=1S/C25H31N3O4S2/c1-4-16-28(17-5-2)34(30,31)22-13-6-19(7-14-22)8-15-24(29)27-25-26-23(18-33-25)20-9-11-21(32-3)12-10-20/h6-15,23H,4-5,16-18H2,1-3H3,(H,26,27,29)/b15-8+ |
| InChIKey | RSRXVQCGXWXNTL-OVCLIPMQSA-N |
| XLogP | 4.48 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|