C26H23FN2O3S — CID 89230640
(E)-3-[2-[(3-fluorophenyl)methoxy]phenyl]-N-[4-(4-methoxyphenyl)-4,5-dihydro-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 89230640) has the molecular formula C26H23FN2O3S and a molecular weight of 462.55 g/mol. Its IUPAC name is (E)-3-[2-[(3-fluorophenyl)methoxy]phenyl]-N-[4-(4-methoxyphenyl)-4,5-dihydro-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-[2-[(3-fluorophenyl)methoxy]phenyl]-N-[4-(4-methoxyphenyl)-4,5-dihydro-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89230640 |
| Molecular Formula | C26H23FN2O3S |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | (E)-3-[2-[(3-fluorophenyl)methoxy]phenyl]-N-[4-(4-methoxyphenyl)-4,5-dihydro-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | COc1ccc(C2CSC(NC(=O)/C=C/c3ccccc3OCc3cccc(F)c3)=N2)cc1 |
| InChI | InChI=1S/C26H23FN2O3S/c1-31-22-12-9-19(10-13-22)23-17-33-26(28-23)29-25(30)14-11-20-6-2-3-8-24(20)32-16-18-5-4-7-21(27)15-18/h2-15,23H,16-17H2,1H3,(H,28,29,30)/b14-11+ |
| InChIKey | PDUMDWXVMUYKGF-SDNWHVSQSA-N |
| XLogP | 5.39 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|