C23H30F3N3O4S — CID 89238638
N-[3,5-dimethyl-1-[1-[3-(trifluoromethyl)benzoyl]piperidin-4-yl]sulfonylpiperidin-4-yl]prop-2-enamide (PubChem CID 89238638) has the molecular formula C23H30F3N3O4S and a molecular weight of 501.57 g/mol. Its IUPAC name is N-[3,5-dimethyl-1-[1-[3-(trifluoromethyl)benzoyl]piperidin-4-yl]sulfonylpiperidin-4-yl]prop-2-enamide.
| Compound Name | N-[3,5-dimethyl-1-[1-[3-(trifluoromethyl)benzoyl]piperidin-4-yl]sulfonylpiperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89238638 |
| Molecular Formula | C23H30F3N3O4S |
| Molecular Weight | 501.57 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | N-[3,5-dimethyl-1-[1-[3-(trifluoromethyl)benzoyl]piperidin-4-yl]sulfonylpiperidin-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1C(C)CN(S(=O)(=O)C2CCN(C(=O)c3cccc(C(F)(F)F)c3)CC2)CC1C |
| InChI | InChI=1S/C23H30F3N3O4S/c1-4-20(30)27-21-15(2)13-29(14-16(21)3)34(32,33)19-8-10-28(11-9-19)22(31)17-6-5-7-18(12-17)23(24,25)26/h4-7,12,15-16,19,21H,1,8-11,13-14H2,2-3H3,(H,27,30) |
| InChIKey | MHSLLNAKRPNNMP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.57 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|