C25H33N3O4S — CID 89238972
N-[2,2,6,6-tetramethyl-1-[[6-(2-phenylethoxy)-3-pyridinyl]sulfonyl]piperidin-4-yl]prop-2-enamide (PubChem CID 89238972) has the molecular formula C25H33N3O4S and a molecular weight of 471.62 g/mol. Its IUPAC name is N-[2,2,6,6-tetramethyl-1-[[6-(2-phenylethoxy)-3-pyridinyl]sulfonyl]piperidin-4-yl]prop-2-enamide.
| Compound Name | N-[2,2,6,6-tetramethyl-1-[[6-(2-phenylethoxy)-3-pyridinyl]sulfonyl]piperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89238972 |
| Molecular Formula | C25H33N3O4S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | N-[2,2,6,6-tetramethyl-1-[[6-(2-phenylethoxy)-3-pyridinyl]sulfonyl]piperidin-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CC(C)(C)N(S(=O)(=O)c2ccc(OCCc3ccccc3)nc2)C(C)(C)C1 |
| InChI | InChI=1S/C25H33N3O4S/c1-6-22(29)27-20-16-24(2,3)28(25(4,5)17-20)33(30,31)21-12-13-23(26-18-21)32-15-14-19-10-8-7-9-11-19/h6-13,18,20H,1,14-17H2,2-5H3,(H,27,29) |
| InChIKey | WDYTXVLQGXCNST-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|