C16H19NO5S — CID 89239885
7-(1-morpholin-4-ylethoxy)naphthalene-2-sulfonic acid (PubChem CID 89239885) has the molecular formula C16H19NO5S and a molecular weight of 337.40 g/mol. Its IUPAC name is 7-(1-morpholin-4-ylethoxy)naphthalene-2-sulfonic acid.
| Compound Name | 7-(1-morpholin-4-ylethoxy)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 89239885 |
| Molecular Formula | C16H19NO5S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 7-(1-morpholin-4-ylethoxy)naphthalene-2-sulfonic acid |
| SMILES | CC(Oc1ccc2ccc(S(=O)(=O)O)cc2c1)N1CCOCC1 |
| InChI | InChI=1S/C16H19NO5S/c1-12(17-6-8-21-9-7-17)22-15-4-2-13-3-5-16(23(18,19)20)11-14(13)10-15/h2-5,10-12H,6-9H2,1H3,(H,18,19,20) |
| InChIKey | KRPVQSKRHWBKDU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|