About 4-[4-(2-dimethoxyphosphorylacetyl)-2,3-dimethylphenoxy]-N,N-dimethylbutanamide
4-[4-(2-dimethoxyphosphorylacetyl)-2,3-dimethylphenoxy]-N,N-dimethylbutanamide (PubChem CID 89248477) has the molecular formula C18H28NO6P
and a molecular weight of 385.40 g/mol. Its IUPAC name is 4-[4-(2-dimethoxyphosphorylacetyl)-2,3-dimethylphenoxy]-N,N-dimethylbutanamide.
Molecular Properties
| Compound Name | 4-[4-(2-dimethoxyphosphorylacetyl)-2,3-dimethylphenoxy]-N,N-dimethylbutanamide |
| PubChem CID | 89248477 |
| Molecular Formula | C18H28NO6P |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 4-[4-(2-dimethoxyphosphorylacetyl)-2,3-dimethylphenoxy]-N,N-dimethylbutanamide |
| SMILES | COP(=O)(CC(=O)c1ccc(OCCCC(=O)N(C)C)c(C)c1C)OC |
| InChI | InChI=1S/C18H28NO6P/c1-13-14(2)17(25-11-7-8-18(21)19(3)4)10-9-15(13)16(20)12-26(22,23-5)24-6/h9-10H,7-8,11-12H2,1-6H3 |
| InChIKey | IUHGZICQEZSBBT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(2-dimethoxyphosphorylacetyl)-2,3-dimethylphenoxy]-N,N-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2-dimethoxyphosphorylacetyl)-2,3-dimethylphenoxy]-N,N-dimethylbutanamide?
The IUPAC name of 4-[4-(2-dimethoxyphosphorylacetyl)-2,3-dimethylphenoxy]-N,N-dimethylbutanamide (CID 89248477) is 4-[4-(2-dimethoxyphosphorylacetyl)-2,3-dimethylphenoxy]-N,N-dimethylbutanamide.
What is the SMILES notation for 4-[4-(2-dimethoxyphosphorylacetyl)-2,3-dimethylphenoxy]-N,N-dimethylbutanamide?
The canonical SMILES for 4-[4-(2-dimethoxyphosphorylacetyl)-2,3-dimethylphenoxy]-N,N-dimethylbutanamide is COP(=O)(CC(=O)c1ccc(OCCCC(=O)N(C)C)c(C)c1C)OC.
What is the InChIKey of 4-[4-(2-dimethoxyphosphorylacetyl)-2,3-dimethylphenoxy]-N,N-dimethylbutanamide?
The InChIKey is IUHGZICQEZSBBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28NO6P/c1-13-14(2)17(25-11-7-8-18(21)19(3)4)10-9-15(13)16(20)12-26(22,23-5)24-6/h9-10H,7-8,11-12H2,1-6H3.
What are the key properties of 4-[4-(2-dimethoxyphosphorylacetyl)-2,3-dimethylphenoxy]-N,N-dimethylbutanamide?
4-[4-(2-dimethoxyphosphorylacetyl)-2,3-dimethylphenoxy]-N,N-dimethylbutanamide has a molecular weight of 385.40 g/mol, XLogP of 3.22, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2-dimethoxyphosphorylacetyl)-2,3-dimethylphenoxy]-N,N-dimethylbutanamide is sourced from PubChem (CID 89248477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).