C18H28NO6P — CID 89248477
4-[4-(2-dimethoxyphosphorylacetyl)-2,3-dimethylphenoxy]-N,N-dimethylbutanamide (PubChem CID 89248477) has the molecular formula C18H28NO6P and a molecular weight of 385.40 g/mol. Its IUPAC name is 4-[4-(2-dimethoxyphosphorylacetyl)-2,3-dimethylphenoxy]-N,N-dimethylbutanamide.
| Compound Name | 4-[4-(2-dimethoxyphosphorylacetyl)-2,3-dimethylphenoxy]-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 89248477 |
| Molecular Formula | C18H28NO6P |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 4-[4-(2-dimethoxyphosphorylacetyl)-2,3-dimethylphenoxy]-N,N-dimethylbutanamide |
| SMILES | COP(=O)(CC(=O)c1ccc(OCCCC(=O)N(C)C)c(C)c1C)OC |
| InChI | InChI=1S/C18H28NO6P/c1-13-14(2)17(25-11-7-8-18(21)19(3)4)10-9-15(13)16(20)12-26(22,23-5)24-6/h9-10H,7-8,11-12H2,1-6H3 |
| InChIKey | IUHGZICQEZSBBT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|