C20H36BF6N3 — CID 89251352
dicyano-fluoro-(1,1,2,2,2-pentafluoroethyl)boranuide;tetrabutylazanium (PubChem CID 89251352) has the molecular formula C20H36BF6N3 and a molecular weight of 443.33 g/mol. Its IUPAC name is dicyano-fluoro-(1,1,2,2,2-pentafluoroethyl)boranuide;tetrabutylazanium.
| Compound Name | dicyano-fluoro-(1,1,2,2,2-pentafluoroethyl)boranuide;tetrabutylazanium |
|---|---|
| PubChem CID | 89251352 |
| Molecular Formula | C20H36BF6N3 |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 443.29 |
| IUPAC Name | dicyano-fluoro-(1,1,2,2,2-pentafluoroethyl)boranuide;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.N#C[B-](F)(C#N)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H36N.C4BF6N2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;6-3(7,4(8,9)10)5(11,1-12)2-13/h5-16H2,1-4H3;/q+1;-1 |
| InChIKey | RALBUOMOMODZJH-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|