C11H11IN4O2S — CID 89258322
4-ethyl-2-[(6-iodo-2-methylpyrimidin-4-yl)amino]-1,3-thiazole-5-carboxylic acid (PubChem CID 89258322) has the molecular formula C11H11IN4O2S and a molecular weight of 390.21 g/mol. Its IUPAC name is 4-ethyl-2-[(6-iodo-2-methylpyrimidin-4-yl)amino]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-ethyl-2-[(6-iodo-2-methylpyrimidin-4-yl)amino]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 89258322 |
| Molecular Formula | C11H11IN4O2S |
| Molecular Weight | 390.21 g/mol |
| Exact Mass | 389.96 |
| IUPAC Name | 4-ethyl-2-[(6-iodo-2-methylpyrimidin-4-yl)amino]-1,3-thiazole-5-carboxylic acid |
| SMILES | CCc1nc(Nc2cc(I)nc(C)n2)sc1C(=O)O |
| InChI | InChI=1S/C11H11IN4O2S/c1-3-6-9(10(17)18)19-11(15-6)16-8-4-7(12)13-5(2)14-8/h4H,3H2,1-2H3,(H,17,18)(H,13,14,15,16) |
| InChIKey | XSAWFSXYUSTRQK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.21 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|