C27H37NO2 — CID 89259061
(2E,4E,6E,8E,10E)-N-(4-hydroxyphenyl)-3,7,11-trimethyl-10-propan-2-ylpentadeca-2,4,6,8,10-pentaenamide (PubChem CID 89259061) has the molecular formula C27H37NO2 and a molecular weight of 407.60 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E)-N-(4-hydroxyphenyl)-3,7,11-trimethyl-10-propan-2-ylpentadeca-2,4,6,8,10-pentaenamide.
| Compound Name | (2E,4E,6E,8E,10E)-N-(4-hydroxyphenyl)-3,7,11-trimethyl-10-propan-2-ylpentadeca-2,4,6,8,10-pentaenamide |
|---|---|
| PubChem CID | 89259061 |
| Molecular Formula | C27H37NO2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | (2E,4E,6E,8E,10E)-N-(4-hydroxyphenyl)-3,7,11-trimethyl-10-propan-2-ylpentadeca-2,4,6,8,10-pentaenamide |
| SMILES | CCCC/C(C)=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)Nc1ccc(O)cc1)C(C)C |
| InChI | InChI=1S/C27H37NO2/c1-7-8-12-23(6)26(20(2)3)18-13-21(4)10-9-11-22(5)19-27(30)28-24-14-16-25(29)17-15-24/h9-11,13-20,29H,7-8,12H2,1-6H3,(H,28,30)/b11-9+,18-13+,21-10+,22-19+,26-23- |
| InChIKey | PARRVAYOLIFTDR-OYGAXDMRSA-N |
| XLogP | 7.50 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|