C27H37NO2 — CID 145097731
(2E,4E,6E,8E)-N-(4-hydroxyphenyl)-3,7,11,11-tetramethyl-10-propan-2-ylidenetetradeca-2,4,6,8-tetraenamide (PubChem CID 145097731) has the molecular formula C27H37NO2 and a molecular weight of 407.60 g/mol. Its IUPAC name is (2E,4E,6E,8E)-N-(4-hydroxyphenyl)-3,7,11,11-tetramethyl-10-propan-2-ylidenetetradeca-2,4,6,8-tetraenamide.
| Compound Name | (2E,4E,6E,8E)-N-(4-hydroxyphenyl)-3,7,11,11-tetramethyl-10-propan-2-ylidenetetradeca-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 145097731 |
| Molecular Formula | C27H37NO2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | (2E,4E,6E,8E)-N-(4-hydroxyphenyl)-3,7,11,11-tetramethyl-10-propan-2-ylidenetetradeca-2,4,6,8-tetraenamide |
| SMILES | CCCC(C)(C)C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)Nc1ccc(O)cc1)=C(C)C |
| InChI | InChI=1S/C27H37NO2/c1-8-18-27(6,7)25(20(2)3)17-12-21(4)10-9-11-22(5)19-26(30)28-23-13-15-24(29)16-14-23/h9-17,19,29H,8,18H2,1-7H3,(H,28,30)/b11-9+,17-12+,21-10+,22-19+ |
| InChIKey | JEZSKZUHAKIMIB-CPGOKQLMSA-N |
| XLogP | 7.50 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|