C14H24N2O8 — CID 89260132
(2,5-dioxopyrrolidin-1-yl) 2-[bis(2-ethoxyethoxy)amino]acetate (PubChem CID 89260132) has the molecular formula C14H24N2O8 and a molecular weight of 348.35 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[bis(2-ethoxyethoxy)amino]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[bis(2-ethoxyethoxy)amino]acetate |
|---|---|
| PubChem CID | 89260132 |
| Molecular Formula | C14H24N2O8 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[bis(2-ethoxyethoxy)amino]acetate |
| SMILES | CCOCCON(CC(=O)ON1C(=O)CCC1=O)OCCOCC |
| InChI | InChI=1S/C14H24N2O8/c1-3-20-7-9-22-15(23-10-8-21-4-2)11-14(19)24-16-12(17)5-6-13(16)18/h3-11H2,1-2H3 |
| InChIKey | ZWPCXSGBSGREQL-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 103.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|