About 7,7-dimethyl-1,2,3,5,6,8-hexahydropyrrolizine
7,7-dimethyl-1,2,3,5,6,8-hexahydropyrrolizine (PubChem CID 89262386) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is 7,7-dimethyl-1,2,3,5,6,8-hexahydropyrrolizine.
Analyze 7,7-dimethyl-1,2,3,5,6,8-hexahydropyrrolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-dimethyl-1,2,3,5,6,8-hexahydropyrrolizine?
The IUPAC name of 7,7-dimethyl-1,2,3,5,6,8-hexahydropyrrolizine (CID 89262386) is 7,7-dimethyl-1,2,3,5,6,8-hexahydropyrrolizine.
What is the SMILES notation for 7,7-dimethyl-1,2,3,5,6,8-hexahydropyrrolizine?
The canonical SMILES for 7,7-dimethyl-1,2,3,5,6,8-hexahydropyrrolizine is CC1(C)CCN2CCCC21.
What is the InChIKey of 7,7-dimethyl-1,2,3,5,6,8-hexahydropyrrolizine?
The InChIKey is ZFZJRUPNWJJXIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N/c1-9(2)5-7-10-6-3-4-8(9)10/h8H,3-7H2,1-2H3.
What are the key properties of 7,7-dimethyl-1,2,3,5,6,8-hexahydropyrrolizine?
7,7-dimethyl-1,2,3,5,6,8-hexahydropyrrolizine has a molecular weight of 139.24 g/mol, XLogP of 1.88, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-dimethyl-1,2,3,5,6,8-hexahydropyrrolizine is sourced from PubChem (CID 89262386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).