C17H10F6N4O — CID 89264079
2,3,6-trifluoro-N-[5-[4-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]-2-pyridinyl]benzamide (PubChem CID 89264079) has the molecular formula C17H10F6N4O and a molecular weight of 400.28 g/mol. Its IUPAC name is 2,3,6-trifluoro-N-[5-[4-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]-2-pyridinyl]benzamide.
| Compound Name | 2,3,6-trifluoro-N-[5-[4-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 89264079 |
| Molecular Formula | C17H10F6N4O |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 2,3,6-trifluoro-N-[5-[4-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]-2-pyridinyl]benzamide |
| SMILES | Cc1c(-c2ccc(NC(=O)c3c(F)ccc(F)c3F)nc2)n[nH]c1C(F)(F)F |
| InChI | InChI=1S/C17H10F6N4O/c1-7-14(26-27-15(7)17(21,22)23)8-2-5-11(24-6-8)25-16(28)12-9(18)3-4-10(19)13(12)20/h2-6H,1H3,(H,26,27)(H,24,25,28) |
| InChIKey | INZMUYSNDGQUCF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|