C16H27N3O7S3 — CID 89265742
6-(dihydroxyamino)oxy-N-[[(4S)-4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl]sulfinyl]hexanamide (PubChem CID 89265742) has the molecular formula C16H27N3O7S3 and a molecular weight of 469.61 g/mol. Its IUPAC name is 6-(dihydroxyamino)oxy-N-[[(4S)-4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl]sulfinyl]hexanamide.
| Compound Name | 6-(dihydroxyamino)oxy-N-[[(4S)-4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl]sulfinyl]hexanamide |
|---|---|
| PubChem CID | 89265742 |
| Molecular Formula | C16H27N3O7S3 |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | 6-(dihydroxyamino)oxy-N-[[(4S)-4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl]sulfinyl]hexanamide |
| SMILES | CCN[C@H]1CC(C)S(=O)(=O)c2sc(S(=O)NC(=O)CCCCCON(O)O)cc21 |
| InChI | InChI=1S/C16H27N3O7S3/c1-3-17-13-9-11(2)29(24,25)16-12(13)10-15(27-16)28(23)18-14(20)7-5-4-6-8-26-19(21)22/h10-11,13,17,21-22H,3-9H2,1-2H3,(H,18,20)/t11?,13-,28?/m0/s1 |
| InChIKey | BQGRDSOGBHUVEE-WTKPQFCQSA-N |
| XLogP | 1.68 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|