C15H21Cl2N3O2 — CID 89272450
4,5-dichloro-N-[2-[3-(ethylamino)pyrrolidin-1-yl]-2-oxoethyl]cyclohexa-1,5-diene-1-carboxamide (PubChem CID 89272450) has the molecular formula C15H21Cl2N3O2 and a molecular weight of 346.26 g/mol. Its IUPAC name is 4,5-dichloro-N-[2-[3-(ethylamino)pyrrolidin-1-yl]-2-oxoethyl]cyclohexa-1,5-diene-1-carboxamide.
| Compound Name | 4,5-dichloro-N-[2-[3-(ethylamino)pyrrolidin-1-yl]-2-oxoethyl]cyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 89272450 |
| Molecular Formula | C15H21Cl2N3O2 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 4,5-dichloro-N-[2-[3-(ethylamino)pyrrolidin-1-yl]-2-oxoethyl]cyclohexa-1,5-diene-1-carboxamide |
| SMILES | CCNC1CCN(C(=O)CNC(=O)C2=CCC(Cl)C(Cl)=C2)C1 |
| InChI | InChI=1S/C15H21Cl2N3O2/c1-2-18-11-5-6-20(9-11)14(21)8-19-15(22)10-3-4-12(16)13(17)7-10/h3,7,11-12,18H,2,4-6,8-9H2,1H3,(H,19,22) |
| InChIKey | PCDFCQDRIBUCQG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|