C18H15ClF3N5O2 — CID 89278450
[(2R)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-yl] 2-chloroacetate (PubChem CID 89278450) has the molecular formula C18H15ClF3N5O2 and a molecular weight of 425.80 g/mol. Its IUPAC name is [(2R)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-yl] 2-chloroacetate.
| Compound Name | [(2R)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-yl] 2-chloroacetate |
|---|---|
| PubChem CID | 89278450 |
| Molecular Formula | C18H15ClF3N5O2 |
| Molecular Weight | 425.80 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | [(2R)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-yl] 2-chloroacetate |
| SMILES | CC(c1ncncc1F)[C@@](Cn1cncn1)(OC(=O)CCl)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H15ClF3N5O2/c1-11(17-15(22)6-23-8-25-17)18(29-16(28)5-19,7-27-10-24-9-26-27)13-3-2-12(20)4-14(13)21/h2-4,6,8-11H,5,7H2,1H3/t11?,18-/m1/s1 |
| InChIKey | QFTRBSULRIJMJK-KKIBXBACSA-N |
| XLogP | 2.97 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.80 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|