C30H27F3N5O4P — CID 57072329
dibenzyl [(2R,3S)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-yl] phosphate (PubChem CID 57072329) has the molecular formula C30H27F3N5O4P and a molecular weight of 609.55 g/mol. Its IUPAC name is dibenzyl [(2R,3S)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-yl] phosphate.
| Compound Name | dibenzyl [(2R,3S)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-yl] phosphate |
|---|---|
| PubChem CID | 57072329 |
| Molecular Formula | C30H27F3N5O4P |
| Molecular Weight | 609.55 g/mol |
| Exact Mass | 609.18 |
| IUPAC Name | dibenzyl [(2R,3S)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-yl] phosphate |
| SMILES | C[C@@H](c1ncncc1F)[C@@](Cn1cncn1)(OP(=O)(OCc1ccccc1)OCc1ccccc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C30H27F3N5O4P/c1-22(29-28(33)15-34-19-36-29)30(18-38-21-35-20-37-38,26-13-12-25(31)14-27(26)32)42-43(39,40-16-23-8-4-2-5-9-23)41-17-24-10-6-3-7-11-24/h2-15,19-22H,16-18H2,1H3/t22-,30+/m0/s1 |
| InChIKey | PPIZUUHTKPOPIB-SMSORMJASA-N |
| XLogP | 6.74 |
| TPSA | 101.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.55 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|