C12H24F3NO3S — CID 89281563
N,N-dibutyl-2-(2,2,2-trifluoroethoxy)ethanesulfonamide (PubChem CID 89281563) has the molecular formula C12H24F3NO3S and a molecular weight of 319.39 g/mol. Its IUPAC name is N,N-dibutyl-2-(2,2,2-trifluoroethoxy)ethanesulfonamide.
| Compound Name | N,N-dibutyl-2-(2,2,2-trifluoroethoxy)ethanesulfonamide |
|---|---|
| PubChem CID | 89281563 |
| Molecular Formula | C12H24F3NO3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N,N-dibutyl-2-(2,2,2-trifluoroethoxy)ethanesulfonamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C12H24F3NO3S/c1-3-5-7-16(8-6-4-2)20(17,18)10-9-19-11-12(13,14)15/h3-11H2,1-2H3 |
| InChIKey | HSOVALYWNBFVAI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|