C11H22F3NO3S — CID 89281567
N-butyl-N-propyl-2-(2,2,2-trifluoroethoxy)ethanesulfonamide (PubChem CID 89281567) has the molecular formula C11H22F3NO3S and a molecular weight of 305.36 g/mol. Its IUPAC name is N-butyl-N-propyl-2-(2,2,2-trifluoroethoxy)ethanesulfonamide.
| Compound Name | N-butyl-N-propyl-2-(2,2,2-trifluoroethoxy)ethanesulfonamide |
|---|---|
| PubChem CID | 89281567 |
| Molecular Formula | C11H22F3NO3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N-butyl-N-propyl-2-(2,2,2-trifluoroethoxy)ethanesulfonamide |
| SMILES | CCCCN(CCC)S(=O)(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C11H22F3NO3S/c1-3-5-7-15(6-4-2)19(16,17)9-8-18-10-11(12,13)14/h3-10H2,1-2H3 |
| InChIKey | SFPLBISGIRWTQY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|