C12H22F5NO3S — CID 89281573
N-butyl-2-(2,2,3,3,3-pentafluoropropoxy)-N-propylethanesulfonamide (PubChem CID 89281573) has the molecular formula C12H22F5NO3S and a molecular weight of 355.37 g/mol. Its IUPAC name is N-butyl-2-(2,2,3,3,3-pentafluoropropoxy)-N-propylethanesulfonamide.
| Compound Name | N-butyl-2-(2,2,3,3,3-pentafluoropropoxy)-N-propylethanesulfonamide |
|---|---|
| PubChem CID | 89281573 |
| Molecular Formula | C12H22F5NO3S |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-butyl-2-(2,2,3,3,3-pentafluoropropoxy)-N-propylethanesulfonamide |
| SMILES | CCCCN(CCC)S(=O)(=O)CCOCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H22F5NO3S/c1-3-5-7-18(6-4-2)22(19,20)9-8-21-10-11(13,14)12(15,16)17/h3-10H2,1-2H3 |
| InChIKey | ZTAWVGQYKLOFKG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|