C17H33ClN2O2 — CID 89282926
2-(chloroamino)-N-[(E,3S)-6-ethoxy-2,5-dimethylhex-4-en-3-yl]-N,3,3-trimethylbutanamide (PubChem CID 89282926) has the molecular formula C17H33ClN2O2 and a molecular weight of 332.92 g/mol. Its IUPAC name is 2-(chloroamino)-N-[(E,3S)-6-ethoxy-2,5-dimethylhex-4-en-3-yl]-N,3,3-trimethylbutanamide.
| Compound Name | 2-(chloroamino)-N-[(E,3S)-6-ethoxy-2,5-dimethylhex-4-en-3-yl]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 89282926 |
| Molecular Formula | C17H33ClN2O2 |
| Molecular Weight | 332.92 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 2-(chloroamino)-N-[(E,3S)-6-ethoxy-2,5-dimethylhex-4-en-3-yl]-N,3,3-trimethylbutanamide |
| SMILES | CCOC/C(C)=C/[C@H](C(C)C)N(C)C(=O)C(NCl)C(C)(C)C |
| InChI | InChI=1S/C17H33ClN2O2/c1-9-22-11-13(4)10-14(12(2)3)20(8)16(21)15(19-18)17(5,6)7/h10,12,14-15,19H,9,11H2,1-8H3/b13-10+/t14-,15?/m1/s1 |
| InChIKey | OLVROPWSENKORV-YJETWPSYSA-N |
| XLogP | 3.61 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.92 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|