C16H26O2 — CID 89284187
4-ethyl-6-methyl-2-[(3E,5Z)-2-methylocta-3,5,7-trien-4-yl]-1,3-dioxane (PubChem CID 89284187) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 4-ethyl-6-methyl-2-[(3E,5Z)-2-methylocta-3,5,7-trien-4-yl]-1,3-dioxane.
| Compound Name | 4-ethyl-6-methyl-2-[(3E,5Z)-2-methylocta-3,5,7-trien-4-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 89284187 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 4-ethyl-6-methyl-2-[(3E,5Z)-2-methylocta-3,5,7-trien-4-yl]-1,3-dioxane |
| SMILES | C=C/C=C\C(=C/C(C)C)C1OC(C)CC(CC)O1 |
| InChI | InChI=1S/C16H26O2/c1-6-8-9-14(10-12(3)4)16-17-13(5)11-15(7-2)18-16/h6,8-10,12-13,15-16H,1,7,11H2,2-5H3/b9-8-,14-10+ |
| InChIKey | CXOBOJPNJNQURW-MYSCJDEHSA-N |
| XLogP | 4.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|