C24H26AsN5O2 — CID 89285124
CID 89285124 (PubChem CID 89285124) has the molecular formula C24H26AsN5O2 and a molecular weight of 491.43 g/mol.
| Compound Name | CID 89285124 |
|---|---|
| PubChem CID | 89285124 |
| Molecular Formula | C24H26AsN5O2 |
| Molecular Weight | 491.43 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | — |
| SMILES | CNC(=O)c1nc(-c2cccc(CNCc3cccc(N4CCOCC4)c3)c2)cnc1[As] |
| InChI | InChI=1S/C24H26AsN5O2/c1-26-24(31)22-23(25)28-16-21(29-22)19-6-2-4-17(12-19)14-27-15-18-5-3-7-20(13-18)30-8-10-32-11-9-30/h2-7,12-13,16,27H,8-11,14-15H2,1H3,(H,26,31) |
| InChIKey | BGRFTKFPRCVGMN-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.43 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|