C13H24N2O5 — CID 89288202
methyl 2,2-dideuterio-2-[[(2R)-2,3,4,4,4-pentadeuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trideuteriomethyl)butanoyl]amino]acetate (PubChem CID 89288202) has the molecular formula C13H24N2O5 and a molecular weight of 298.41 g/mol. Its IUPAC name is methyl 2,2-dideuterio-2-[[(2R)-2,3,4,4,4-pentadeuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trideuteriomethyl)butanoyl]amino]acetate.
| Compound Name | methyl 2,2-dideuterio-2-[[(2R)-2,3,4,4,4-pentadeuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trideuteriomethyl)butanoyl]amino]acetate |
|---|---|
| PubChem CID | 89288202 |
| Molecular Formula | C13H24N2O5 |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | methyl 2,2-dideuterio-2-[[(2R)-2,3,4,4,4-pentadeuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trideuteriomethyl)butanoyl]amino]acetate |
| SMILES | [2H]C([2H])(NC(=O)[C@]([2H])(NC(=O)OC(C)(C)C)C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])C(=O)OC |
| InChI | InChI=1S/C13H24N2O5/c1-8(2)10(11(17)14-7-9(16)19-6)15-12(18)20-13(3,4)5/h8,10H,7H2,1-6H3,(H,14,17)(H,15,18)/t10-/m1/s1/i1D3,2D3,7D2,8D,10D |
| InChIKey | ANHLFUWXEKATOI-WMBWEBJMSA-N |
| XLogP | 0.82 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |