C31H21N4O12S3- — CID 89289285
6-[[3-carboxy-4-[[4-(phenylcarbamoyl)benzoyl]amino]phenyl]diazenyl]-4,8-disulfonaphthalene-2-sulfinate (PubChem CID 89289285) has the molecular formula C31H21N4O12S3- and a molecular weight of 737.73 g/mol. Its IUPAC name is 6-[[3-carboxy-4-[[4-(phenylcarbamoyl)benzoyl]amino]phenyl]diazenyl]-4,8-disulfonaphthalene-2-sulfinate.
| Compound Name | 6-[[3-carboxy-4-[[4-(phenylcarbamoyl)benzoyl]amino]phenyl]diazenyl]-4,8-disulfonaphthalene-2-sulfinate |
|---|---|
| PubChem CID | 89289285 |
| Molecular Formula | C31H21N4O12S3- |
| Molecular Weight | 737.73 g/mol |
| Exact Mass | 737.03 |
| IUPAC Name | 6-[[3-carboxy-4-[[4-(phenylcarbamoyl)benzoyl]amino]phenyl]diazenyl]-4,8-disulfonaphthalene-2-sulfinate |
| SMILES | O=C(Nc1ccccc1)c1ccc(C(=O)Nc2ccc(/N=N/c3cc(S(=O)(=O)O)c4cc(S(=O)[O-])cc(S(=O)(=O)O)c4c3)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C31H22N4O12S3/c36-29(32-19-4-2-1-3-5-19)17-6-8-18(9-7-17)30(37)33-26-11-10-20(12-25(26)31(38)39)34-35-21-13-23-24(27(14-21)49(42,43)44)15-22(48(40)41)16-28(23)50(45,46)47/h1-16H,(H,32,36)(H,33,37)(H,38,39)(H,40,41)(H,42,43,44)(H,45,46,47)/p-1/b35-34+ |
| InChIKey | DCGOPKKMLXSKHT-XAHDOWKMSA-M |
| XLogP | 5.19 |
| TPSA | 269.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.73 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|