C21H32O6 — CID 89293321
1-[1-[2-[3-(2-ethenoxyethoxy)phenyl]-6-ethyl-1,3-dioxan-4-yl]propan-2-yloxy]ethanol (PubChem CID 89293321) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is 1-[1-[2-[3-(2-ethenoxyethoxy)phenyl]-6-ethyl-1,3-dioxan-4-yl]propan-2-yloxy]ethanol.
| Compound Name | 1-[1-[2-[3-(2-ethenoxyethoxy)phenyl]-6-ethyl-1,3-dioxan-4-yl]propan-2-yloxy]ethanol |
|---|---|
| PubChem CID | 89293321 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 1-[1-[2-[3-(2-ethenoxyethoxy)phenyl]-6-ethyl-1,3-dioxan-4-yl]propan-2-yloxy]ethanol |
| SMILES | C=COCCOc1cccc(C2OC(CC)CC(CC(C)OC(C)O)O2)c1 |
| InChI | InChI=1S/C21H32O6/c1-5-18-14-20(12-15(3)25-16(4)22)27-21(26-18)17-8-7-9-19(13-17)24-11-10-23-6-2/h6-9,13,15-16,18,20-22H,2,5,10-12,14H2,1,3-4H3 |
| InChIKey | MQVJIRWUWZDWRS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|