C14H14F3NO2 — CID 89294794
[2-[(Z)-2-amino-1,2-difluoroethenyl]-4-fluoropent-4-enyl] benzoate (PubChem CID 89294794) has the molecular formula C14H14F3NO2 and a molecular weight of 285.26 g/mol. Its IUPAC name is [2-[(Z)-2-amino-1,2-difluoroethenyl]-4-fluoropent-4-enyl] benzoate.
| Compound Name | [2-[(Z)-2-amino-1,2-difluoroethenyl]-4-fluoropent-4-enyl] benzoate |
|---|---|
| PubChem CID | 89294794 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | [2-[(Z)-2-amino-1,2-difluoroethenyl]-4-fluoropent-4-enyl] benzoate |
| SMILES | C=C(F)CC(COC(=O)c1ccccc1)/C(F)=C(\N)F |
| InChI | InChI=1S/C14H14F3NO2/c1-9(15)7-11(12(16)13(17)18)8-20-14(19)10-5-3-2-4-6-10/h2-6,11H,1,7-8,18H2/b13-12+ |
| InChIKey | GTXYZCTWRDGWAK-OUKQBFOZSA-N |
| XLogP | 3.40 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|