C34H25N — CID 89296764
3-(9,9-dimethylfluoren-2-yl)-10a,12b-dihydropyreno[1,2-b]pyridine (PubChem CID 89296764) has the molecular formula C34H25N and a molecular weight of 447.58 g/mol. Its IUPAC name is 3-(9,9-dimethylfluoren-2-yl)-10a,12b-dihydropyreno[1,2-b]pyridine.
| Compound Name | 3-(9,9-dimethylfluoren-2-yl)-10a,12b-dihydropyreno[1,2-b]pyridine |
|---|---|
| PubChem CID | 89296764 |
| Molecular Formula | C34H25N |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 3-(9,9-dimethylfluoren-2-yl)-10a,12b-dihydropyreno[1,2-b]pyridine |
| SMILES | CC1(C)c2ccccc2-c2ccc(C3=C4C=CC5=C6C(=CC=C(C=C3)C46)C3N=CC=CC3=C5)cc21 |
| InChI | InChI=1S/C34H25N/c1-34(2)29-8-4-3-7-25(29)26-14-11-21(19-30(26)34)24-13-9-20-10-16-28-32-22(12-15-27(24)31(20)32)18-23-6-5-17-35-33(23)28/h3-19,31,33H,1-2H3 |
| InChIKey | SKLOOGPLBNFPCE-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |