C27H46NO4+ — CID 89297312
ethyl 1-methyl-1-[2-[2-(4-octylphenoxy)ethoxy]ethyl]piperidin-1-ium-2-carboxylate (PubChem CID 89297312) has the molecular formula C27H46NO4+ and a molecular weight of 448.67 g/mol. Its IUPAC name is ethyl 1-methyl-1-[2-[2-(4-octylphenoxy)ethoxy]ethyl]piperidin-1-ium-2-carboxylate.
| Compound Name | ethyl 1-methyl-1-[2-[2-(4-octylphenoxy)ethoxy]ethyl]piperidin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 89297312 |
| Molecular Formula | C27H46NO4+ |
| Molecular Weight | 448.67 g/mol |
| Exact Mass | 448.34 |
| IUPAC Name | ethyl 1-methyl-1-[2-[2-(4-octylphenoxy)ethoxy]ethyl]piperidin-1-ium-2-carboxylate |
| SMILES | CCCCCCCCc1ccc(OCCOCC[N+]2(C)CCCCC2C(=O)OCC)cc1 |
| InChI | InChI=1S/C27H46NO4/c1-4-6-7-8-9-10-13-24-15-17-25(18-16-24)32-23-22-30-21-20-28(3)19-12-11-14-26(28)27(29)31-5-2/h15-18,26H,4-14,19-23H2,1-3H3/q+1 |
| InChIKey | BAFGVOLXWVHENE-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.67 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|