2-(2,3-dihydrofuran-2-yl)acetic acid

C6H8O3 — CID 89299467

IUPAC2-(2,3-dihydrofuran-2-yl)acetic acid
SMILESO=C(O)CC1CC=CO1
InChIInChI=1S/C6H8O3/c7-6(8)4-5-2-1-3-9-5/h1,3,5H,2,4H2,(H,7,8)
InChIKeyFHVYYXBDVZNTIV-UHFFFAOYSA-N
MW128.13 g/mol
LogP0.76
Rot. Bonds2

About 2-(2,3-dihydrofuran-2-yl)acetic acid

2-(2,3-dihydrofuran-2-yl)acetic acid (PubChem CID 89299467) has the molecular formula C6H8O3 and a molecular weight of 128.13 g/mol. Its IUPAC name is 2-(2,3-dihydrofuran-2-yl)acetic acid.

Molecular Properties

Compound Name2-(2,3-dihydrofuran-2-yl)acetic acid
PubChem CID89299467
Molecular FormulaC6H8O3
Molecular Weight128.13 g/mol
Exact Mass128.05
IUPAC Name2-(2,3-dihydrofuran-2-yl)acetic acid
SMILESO=C(O)CC1CC=CO1
InChIInChI=1S/C6H8O3/c7-6(8)4-5-2-1-3-9-5/h1,3,5H,2,4H2,(H,7,8)
InChIKeyFHVYYXBDVZNTIV-UHFFFAOYSA-N
XLogP0.76
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500128.13
LogP ≤ 50.76
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(2,3-dihydrofuran-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3-dihydrofuran-2-yl)acetic acid?
The IUPAC name of 2-(2,3-dihydrofuran-2-yl)acetic acid (CID 89299467) is 2-(2,3-dihydrofuran-2-yl)acetic acid.
What is the SMILES notation for 2-(2,3-dihydrofuran-2-yl)acetic acid?
The canonical SMILES for 2-(2,3-dihydrofuran-2-yl)acetic acid is O=C(O)CC1CC=CO1.
What is the InChIKey of 2-(2,3-dihydrofuran-2-yl)acetic acid?
The InChIKey is FHVYYXBDVZNTIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O3/c7-6(8)4-5-2-1-3-9-5/h1,3,5H,2,4H2,(H,7,8).
What are the key properties of 2-(2,3-dihydrofuran-2-yl)acetic acid?
2-(2,3-dihydrofuran-2-yl)acetic acid has a molecular weight of 128.13 g/mol, XLogP of 0.76, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydrofuran-2-yl)acetic acid is sourced from PubChem (CID 89299467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).