C10H9ClF3NOS — CID 89304668
(Z)-2-amino-2-[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]ethenethiol (PubChem CID 89304668) has the molecular formula C10H9ClF3NOS and a molecular weight of 283.70 g/mol. Its IUPAC name is (Z)-2-amino-2-[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]ethenethiol.
| Compound Name | (Z)-2-amino-2-[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]ethenethiol |
|---|---|
| PubChem CID | 89304668 |
| Molecular Formula | C10H9ClF3NOS |
| Molecular Weight | 283.70 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | (Z)-2-amino-2-[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]ethenethiol |
| SMILES | N/C(=C\S)c1ccc(OCC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C10H9ClF3NOS/c11-7-3-6(8(15)4-17)1-2-9(7)16-5-10(12,13)14/h1-4,17H,5,15H2/b8-4- |
| InChIKey | XKCPALDEYVJNPC-YWEYNIOJSA-N |
| XLogP | 3.47 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.70 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|