C32H28F6N2O6 — CID 89307114
4-[[2-[(3aR,9S,9aR)-4-[4-(trifluoromethoxy)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-4-(trifluoromethoxy)benzoyl]amino]butanoic acid (PubChem CID 89307114) has the molecular formula C32H28F6N2O6 and a molecular weight of 650.57 g/mol. Its IUPAC name is 4-[[2-[(3aR,9S,9aR)-4-[4-(trifluoromethoxy)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-4-(trifluoromethoxy)benzoyl]amino]butanoic acid.
| Compound Name | 4-[[2-[(3aR,9S,9aR)-4-[4-(trifluoromethoxy)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-4-(trifluoromethoxy)benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 89307114 |
| Molecular Formula | C32H28F6N2O6 |
| Molecular Weight | 650.57 g/mol |
| Exact Mass | 650.19 |
| IUPAC Name | 4-[[2-[(3aR,9S,9aR)-4-[4-(trifluoromethoxy)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-4-(trifluoromethoxy)benzoyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)c1ccc(OC(F)(F)F)cc1[C@H]1c2ccccc2N(C(=O)c2ccc(OC(F)(F)F)cc2)[C@@H]2CCC[C@H]12 |
| InChI | InChI=1S/C32H28F6N2O6/c33-31(34,35)45-19-12-10-18(11-13-19)30(44)40-25-7-2-1-5-22(25)28(23-6-3-8-26(23)40)24-17-20(46-32(36,37)38)14-15-21(24)29(43)39-16-4-9-27(41)42/h1-2,5,7,10-15,17,23,26,28H,3-4,6,8-9,16H2,(H,39,43)(H,41,42)/t23-,26+,28-/m0/s1 |
| InChIKey | BOKYYFQHFOUTKZ-AQHOXQCLSA-N |
| XLogP | 7.04 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.57 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|