C29H30F3N3O3S — CID 89307286
tert-butyl 1-[[4-[(Z)-N'-[1-[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]ethenoxy]carbamimidoyl]phenyl]methyl]azetidine-3-carboxylate (PubChem CID 89307286) has the molecular formula C29H30F3N3O3S and a molecular weight of 557.64 g/mol. Its IUPAC name is tert-butyl 1-[[4-[(Z)-N'-[1-[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]ethenoxy]carbamimidoyl]phenyl]methyl]azetidine-3-carboxylate.
| Compound Name | tert-butyl 1-[[4-[(Z)-N'-[1-[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]ethenoxy]carbamimidoyl]phenyl]methyl]azetidine-3-carboxylate |
|---|---|
| PubChem CID | 89307286 |
| Molecular Formula | C29H30F3N3O3S |
| Molecular Weight | 557.64 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | tert-butyl 1-[[4-[(Z)-N'-[1-[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]ethenoxy]carbamimidoyl]phenyl]methyl]azetidine-3-carboxylate |
| SMILES | C=C(O/N=C(\N)c1ccc(CN2CC(C(=O)OC(C)(C)C)C2)cc1)c1cc(-c2ccccc2)c(C(F)(F)F)s1 |
| InChI | InChI=1S/C29H30F3N3O3S/c1-18(24-14-23(20-8-6-5-7-9-20)25(39-24)29(30,31)32)38-34-26(33)21-12-10-19(11-13-21)15-35-16-22(17-35)27(36)37-28(2,3)4/h5-14,22H,1,15-17H2,2-4H3,(H2,33,34) |
| InChIKey | SFRDSYJMEIJYNL-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.64 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|