C30H31F3N2O2 — CID 90346044
1-[1-[[4-[(E)-C-methyl-N-[[4-phenyl-3-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]methyl]piperidin-3-yl]ethenol (PubChem CID 90346044) has the molecular formula C30H31F3N2O2 and a molecular weight of 508.58 g/mol. Its IUPAC name is 1-[1-[[4-[(E)-C-methyl-N-[[4-phenyl-3-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]methyl]piperidin-3-yl]ethenol.
| Compound Name | 1-[1-[[4-[(E)-C-methyl-N-[[4-phenyl-3-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]methyl]piperidin-3-yl]ethenol |
|---|---|
| PubChem CID | 90346044 |
| Molecular Formula | C30H31F3N2O2 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | 1-[1-[[4-[(E)-C-methyl-N-[[4-phenyl-3-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]methyl]piperidin-3-yl]ethenol |
| SMILES | C=C(O)C1CCCN(Cc2ccc(/C(C)=N/OCc3ccc(-c4ccccc4)c(C(F)(F)F)c3)cc2)C1 |
| InChI | InChI=1S/C30H31F3N2O2/c1-21(25-13-10-23(11-14-25)18-35-16-6-9-27(19-35)22(2)36)34-37-20-24-12-15-28(26-7-4-3-5-8-26)29(17-24)30(31,32)33/h3-5,7-8,10-15,17,27,36H,2,6,9,16,18-20H2,1H3/b34-21+ |
| InChIKey | PINUFHVEPXIRDO-KEIPNQJHSA-N |
| XLogP | 7.60 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|