C28H36F3N3O4S — CID 156682760
[4-amino-1-[4-[N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]phenyl]sulfonylpiperidin-4-yl]methanol (PubChem CID 156682760) has the molecular formula C28H36F3N3O4S and a molecular weight of 567.67 g/mol. Its IUPAC name is [4-amino-1-[4-[N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]phenyl]sulfonylpiperidin-4-yl]methanol.
| Compound Name | [4-amino-1-[4-[N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]phenyl]sulfonylpiperidin-4-yl]methanol |
|---|---|
| PubChem CID | 156682760 |
| Molecular Formula | C28H36F3N3O4S |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | [4-amino-1-[4-[N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]phenyl]sulfonylpiperidin-4-yl]methanol |
| SMILES | CC(=NOCc1ccc(C2CCCCC2)c(C(F)(F)F)c1)c1ccc(S(=O)(=O)N2CCC(N)(CO)CC2)cc1 |
| InChI | InChI=1S/C28H36F3N3O4S/c1-20(22-8-10-24(11-9-22)39(36,37)34-15-13-27(32,19-35)14-16-34)33-38-18-21-7-12-25(23-5-3-2-4-6-23)26(17-21)28(29,30)31/h7-12,17,23,35H,2-6,13-16,18-19,32H2,1H3 |
| InChIKey | XCWWLGHQOAQVHO-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|