C14H20N2O4S — CID 137480244
1-[4-[4-amino-4-(hydroxymethyl)piperidin-1-yl]sulfonylphenyl]ethanone (PubChem CID 137480244) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 1-[4-[4-amino-4-(hydroxymethyl)piperidin-1-yl]sulfonylphenyl]ethanone.
| Compound Name | 1-[4-[4-amino-4-(hydroxymethyl)piperidin-1-yl]sulfonylphenyl]ethanone |
|---|---|
| PubChem CID | 137480244 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 1-[4-[4-amino-4-(hydroxymethyl)piperidin-1-yl]sulfonylphenyl]ethanone |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCC(N)(CO)CC2)cc1 |
| InChI | InChI=1S/C14H20N2O4S/c1-11(18)12-2-4-13(5-3-12)21(19,20)16-8-6-14(15,10-17)7-9-16/h2-5,17H,6-10,15H2,1H3 |
| InChIKey | RBKQOSVWTLQZGI-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |