C23H27N3O4S — CID 91565819
8-(4-acetylphenyl)sulfonyl-4-benzyl-1-methyl-1,4,8-triazaspiro[4.5]decan-3-one (PubChem CID 91565819) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is 8-(4-acetylphenyl)sulfonyl-4-benzyl-1-methyl-1,4,8-triazaspiro[4.5]decan-3-one.
| Compound Name | 8-(4-acetylphenyl)sulfonyl-4-benzyl-1-methyl-1,4,8-triazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 91565819 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 8-(4-acetylphenyl)sulfonyl-4-benzyl-1-methyl-1,4,8-triazaspiro[4.5]decan-3-one |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCC3(CC2)N(C)CC(=O)N3Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H27N3O4S/c1-18(27)20-8-10-21(11-9-20)31(29,30)25-14-12-23(13-15-25)24(2)17-22(28)26(23)16-19-6-4-3-5-7-19/h3-11H,12-17H2,1-2H3 |
| InChIKey | XSZVQBJPLVDBJI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |