C23H28BNO4 — CID 89309578
(2R)-4-[3-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]-2-(phenylmethoxymethyl)morpholine (PubChem CID 89309578) has the molecular formula C23H28BNO4 and a molecular weight of 393.29 g/mol. Its IUPAC name is (2R)-4-[3-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]-2-(phenylmethoxymethyl)morpholine.
| Compound Name | (2R)-4-[3-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]-2-(phenylmethoxymethyl)morpholine |
|---|---|
| PubChem CID | 89309578 |
| Molecular Formula | C23H28BNO4 |
| Molecular Weight | 393.29 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | (2R)-4-[3-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]-2-(phenylmethoxymethyl)morpholine |
| SMILES | C=C1OB(c2cccc(N3CCO[C@@H](COCc4ccccc4)C3)c2)OC1(C)C |
| InChI | InChI=1S/C23H28BNO4/c1-18-23(2,3)29-24(28-18)20-10-7-11-21(14-20)25-12-13-27-22(15-25)17-26-16-19-8-5-4-6-9-19/h4-11,14,22H,1,12-13,15-17H2,2-3H3/t22-/m1/s1 |
| InChIKey | DTTNKQSHAJSSNZ-JOCHJYFZSA-N |
| XLogP | 3.14 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|