C13H11ClF2N2O — CID 89311601
N-[(1E)-2-[(3,4-difluorobenzoyl)amino]buta-1,3-dienyl]ethanimidoyl chloride (PubChem CID 89311601) has the molecular formula C13H11ClF2N2O and a molecular weight of 284.69 g/mol. Its IUPAC name is N-[(1E)-2-[(3,4-difluorobenzoyl)amino]buta-1,3-dienyl]ethanimidoyl chloride.
| Compound Name | N-[(1E)-2-[(3,4-difluorobenzoyl)amino]buta-1,3-dienyl]ethanimidoyl chloride |
|---|---|
| PubChem CID | 89311601 |
| Molecular Formula | C13H11ClF2N2O |
| Molecular Weight | 284.69 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | N-[(1E)-2-[(3,4-difluorobenzoyl)amino]buta-1,3-dienyl]ethanimidoyl chloride |
| SMILES | C=C/C(=C\N=C(/C)Cl)NC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H11ClF2N2O/c1-3-10(7-17-8(2)14)18-13(19)9-4-5-11(15)12(16)6-9/h3-7H,1H2,2H3,(H,18,19)/b10-7+,17-8+ |
| InChIKey | SRNUWQGHWBMLSI-WQQSFHBXSA-N |
| XLogP | 3.38 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.69 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|