About N-[(1E)-2-[(3,4-difluorobenzoyl)amino]buta-1,3-dienyl]ethanimidoyl chloride
N-[(1E)-2-[(3,4-difluorobenzoyl)amino]buta-1,3-dienyl]ethanimidoyl chloride (PubChem CID 89311601) has the molecular formula C13H11ClF2N2O
and a molecular weight of 284.69 g/mol. Its IUPAC name is N-[(1E)-2-[(3,4-difluorobenzoyl)amino]buta-1,3-dienyl]ethanimidoyl chloride.
Molecular Properties
| Compound Name | N-[(1E)-2-[(3,4-difluorobenzoyl)amino]buta-1,3-dienyl]ethanimidoyl chloride |
| PubChem CID | 89311601 |
| Molecular Formula | C13H11ClF2N2O |
| Molecular Weight | 284.69 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | N-[(1E)-2-[(3,4-difluorobenzoyl)amino]buta-1,3-dienyl]ethanimidoyl chloride |
| SMILES | C=C/C(=C\N=C(/C)Cl)NC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H11ClF2N2O/c1-3-10(7-17-8(2)14)18-13(19)9-4-5-11(15)12(16)6-9/h3-7H,1H2,2H3,(H,18,19)/b10-7+,17-8+ |
| InChIKey | SRNUWQGHWBMLSI-WQQSFHBXSA-N |
| XLogP | 3.38 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.69 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1E)-2-[(3,4-difluorobenzoyl)amino]buta-1,3-dienyl]ethanimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1E)-2-[(3,4-difluorobenzoyl)amino]buta-1,3-dienyl]ethanimidoyl chloride?
The IUPAC name of N-[(1E)-2-[(3,4-difluorobenzoyl)amino]buta-1,3-dienyl]ethanimidoyl chloride (CID 89311601) is N-[(1E)-2-[(3,4-difluorobenzoyl)amino]buta-1,3-dienyl]ethanimidoyl chloride.
What is the SMILES notation for N-[(1E)-2-[(3,4-difluorobenzoyl)amino]buta-1,3-dienyl]ethanimidoyl chloride?
The canonical SMILES for N-[(1E)-2-[(3,4-difluorobenzoyl)amino]buta-1,3-dienyl]ethanimidoyl chloride is C=C/C(=C\N=C(/C)Cl)NC(=O)c1ccc(F)c(F)c1.
What is the InChIKey of N-[(1E)-2-[(3,4-difluorobenzoyl)amino]buta-1,3-dienyl]ethanimidoyl chloride?
The InChIKey is SRNUWQGHWBMLSI-WQQSFHBXSA-N. The full InChI is InChI=1S/C13H11ClF2N2O/c1-3-10(7-17-8(2)14)18-13(19)9-4-5-11(15)12(16)6-9/h3-7H,1H2,2H3,(H,18,19)/b10-7+,17-8+.
What are the key properties of N-[(1E)-2-[(3,4-difluorobenzoyl)amino]buta-1,3-dienyl]ethanimidoyl chloride?
N-[(1E)-2-[(3,4-difluorobenzoyl)amino]buta-1,3-dienyl]ethanimidoyl chloride has a molecular weight of 284.69 g/mol, XLogP of 3.38, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1E)-2-[(3,4-difluorobenzoyl)amino]buta-1,3-dienyl]ethanimidoyl chloride is sourced from PubChem (CID 89311601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).