C15H27NO10 — CID 89312260
3-[3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)-2-(2-hydroxyethylamino)propoxy]propanoic acid (PubChem CID 89312260) has the molecular formula C15H27NO10 and a molecular weight of 381.38 g/mol. Its IUPAC name is 3-[3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)-2-(2-hydroxyethylamino)propoxy]propanoic acid.
| Compound Name | 3-[3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)-2-(2-hydroxyethylamino)propoxy]propanoic acid |
|---|---|
| PubChem CID | 89312260 |
| Molecular Formula | C15H27NO10 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 3-[3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)-2-(2-hydroxyethylamino)propoxy]propanoic acid |
| SMILES | O=C(O)CCOCC(COCCC(=O)O)(COCCC(=O)O)NCCO |
| InChI | InChI=1S/C15H27NO10/c17-5-4-16-15(9-24-6-1-12(18)19,10-25-7-2-13(20)21)11-26-8-3-14(22)23/h16-17H,1-11H2,(H,18,19)(H,20,21)(H,22,23) |
| InChIKey | SQXGJRBLRFWCJQ-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 171.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|