C14H16F2 — CID 89312736
1,4-difluoro-2,3,5-trimethyl-6-[(1Z)-2-methylbuta-1,3-dienyl]benzene (PubChem CID 89312736) has the molecular formula C14H16F2 and a molecular weight of 222.28 g/mol. Its IUPAC name is 1,4-difluoro-2,3,5-trimethyl-6-[(1Z)-2-methylbuta-1,3-dienyl]benzene.
| Compound Name | 1,4-difluoro-2,3,5-trimethyl-6-[(1Z)-2-methylbuta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 89312736 |
| Molecular Formula | C14H16F2 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 1,4-difluoro-2,3,5-trimethyl-6-[(1Z)-2-methylbuta-1,3-dienyl]benzene |
| SMILES | C=C/C(C)=C\c1c(C)c(F)c(C)c(C)c1F |
| InChI | InChI=1S/C14H16F2/c1-6-8(2)7-12-11(5)13(15)9(3)10(4)14(12)16/h6-7H,1H2,2-5H3/b8-7- |
| InChIKey | UAEBGMRFAOZBKS-FPLPWBNLSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|