C16H16FN3O4S — CID 89313136
ethyl 2-amino-3-[2-[(3-fluorobenzoyl)amino]-4-methyl-1,3-thiazol-5-yl]-3-oxopropanoate (PubChem CID 89313136) has the molecular formula C16H16FN3O4S and a molecular weight of 365.39 g/mol. Its IUPAC name is ethyl 2-amino-3-[2-[(3-fluorobenzoyl)amino]-4-methyl-1,3-thiazol-5-yl]-3-oxopropanoate.
| Compound Name | ethyl 2-amino-3-[2-[(3-fluorobenzoyl)amino]-4-methyl-1,3-thiazol-5-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 89313136 |
| Molecular Formula | C16H16FN3O4S |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | ethyl 2-amino-3-[2-[(3-fluorobenzoyl)amino]-4-methyl-1,3-thiazol-5-yl]-3-oxopropanoate |
| SMILES | CCOC(=O)C(N)C(=O)c1sc(NC(=O)c2cccc(F)c2)nc1C |
| InChI | InChI=1S/C16H16FN3O4S/c1-3-24-15(23)11(18)12(21)13-8(2)19-16(25-13)20-14(22)9-5-4-6-10(17)7-9/h4-7,11H,3,18H2,1-2H3,(H,19,20,22) |
| InChIKey | BHTCBIPVCQTOFG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|