C22H24FIN6O2 — CID 89316297
3-[[4-[2-fluoro-3-(iodomethyl)anilino]-7-methoxyquinazolin-6-yl]methyl-methylamino]azetidine-3-carboxamide (PubChem CID 89316297) has the molecular formula C22H24FIN6O2 and a molecular weight of 550.38 g/mol. Its IUPAC name is 3-[[4-[2-fluoro-3-(iodomethyl)anilino]-7-methoxyquinazolin-6-yl]methyl-methylamino]azetidine-3-carboxamide.
| Compound Name | 3-[[4-[2-fluoro-3-(iodomethyl)anilino]-7-methoxyquinazolin-6-yl]methyl-methylamino]azetidine-3-carboxamide |
|---|---|
| PubChem CID | 89316297 |
| Molecular Formula | C22H24FIN6O2 |
| Molecular Weight | 550.38 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | 3-[[4-[2-fluoro-3-(iodomethyl)anilino]-7-methoxyquinazolin-6-yl]methyl-methylamino]azetidine-3-carboxamide |
| SMILES | COc1cc2ncnc(Nc3cccc(CI)c3F)c2cc1CN(C)C1(C(N)=O)CNC1 |
| InChI | InChI=1S/C22H24FIN6O2/c1-30(22(21(25)31)10-26-11-22)9-14-6-15-17(7-18(14)32-2)27-12-28-20(15)29-16-5-3-4-13(8-24)19(16)23/h3-7,12,26H,8-11H2,1-2H3,(H2,25,31)(H,27,28,29) |
| InChIKey | LNEKBLNYSKDJIK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|