C19H22BNO2 — CID 89318794
CID 89318794 (PubChem CID 89318794) has the molecular formula C19H22BNO2 and a molecular weight of 307.20 g/mol.
| Compound Name | CID 89318794 |
|---|---|
| PubChem CID | 89318794 |
| Molecular Formula | C19H22BNO2 |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | — |
| SMILES | [B]C(Cc1ccc(CCCc2ccc(CC)cn2)cc1)C(=O)O |
| InChI | InChI=1S/C19H22BNO2/c1-2-14-10-11-17(21-13-14)5-3-4-15-6-8-16(9-7-15)12-18(20)19(22)23/h6-11,13,18H,2-5,12H2,1H3,(H,22,23) |
| InChIKey | PROUJBSDXCIAIC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|