About (E)-4-[4-[3-(5-ethyl-2-pyridinyl)propyl]phenyl]-3-methylbut-3-en-2-one;propan-2-one
(E)-4-[4-[3-(5-ethyl-2-pyridinyl)propyl]phenyl]-3-methylbut-3-en-2-one;propan-2-one (PubChem CID 142872927) has the molecular formula C24H31NO2
and a molecular weight of 365.52 g/mol. Its IUPAC name is (E)-4-[4-[3-(5-ethyl-2-pyridinyl)propyl]phenyl]-3-methylbut-3-en-2-one;propan-2-one.
Molecular Properties
| Compound Name | (E)-4-[4-[3-(5-ethyl-2-pyridinyl)propyl]phenyl]-3-methylbut-3-en-2-one;propan-2-one |
| PubChem CID | 142872927 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | (E)-4-[4-[3-(5-ethyl-2-pyridinyl)propyl]phenyl]-3-methylbut-3-en-2-one;propan-2-one |
| SMILES | CC(C)=O.CCc1ccc(CCCc2ccc(/C=C(\C)C(C)=O)cc2)nc1 |
| InChI | InChI=1S/C21H25NO.C3H6O/c1-4-18-12-13-21(22-15-18)7-5-6-19-8-10-20(11-9-19)14-16(2)17(3)23;1-3(2)4/h8-15H,4-7H2,1-3H3;1-2H3/b16-14+; |
| InChIKey | GRVMRWMTMZFCKD-BACBYAOASA-N |
| XLogP | 5.41 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-[4-[3-(5-ethyl-2-pyridinyl)propyl]phenyl]-3-methylbut-3-en-2-one;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-[4-[3-(5-ethyl-2-pyridinyl)propyl]phenyl]-3-methylbut-3-en-2-one;propan-2-one?
The IUPAC name of (E)-4-[4-[3-(5-ethyl-2-pyridinyl)propyl]phenyl]-3-methylbut-3-en-2-one;propan-2-one (CID 142872927) is (E)-4-[4-[3-(5-ethyl-2-pyridinyl)propyl]phenyl]-3-methylbut-3-en-2-one;propan-2-one.
What is the SMILES notation for (E)-4-[4-[3-(5-ethyl-2-pyridinyl)propyl]phenyl]-3-methylbut-3-en-2-one;propan-2-one?
The canonical SMILES for (E)-4-[4-[3-(5-ethyl-2-pyridinyl)propyl]phenyl]-3-methylbut-3-en-2-one;propan-2-one is CC(C)=O.CCc1ccc(CCCc2ccc(/C=C(\C)C(C)=O)cc2)nc1.
What is the InChIKey of (E)-4-[4-[3-(5-ethyl-2-pyridinyl)propyl]phenyl]-3-methylbut-3-en-2-one;propan-2-one?
The InChIKey is GRVMRWMTMZFCKD-BACBYAOASA-N. The full InChI is InChI=1S/C21H25NO.C3H6O/c1-4-18-12-13-21(22-15-18)7-5-6-19-8-10-20(11-9-19)14-16(2)17(3)23;1-3(2)4/h8-15H,4-7H2,1-3H3;1-2H3/b16-14+;.
What are the key properties of (E)-4-[4-[3-(5-ethyl-2-pyridinyl)propyl]phenyl]-3-methylbut-3-en-2-one;propan-2-one?
(E)-4-[4-[3-(5-ethyl-2-pyridinyl)propyl]phenyl]-3-methylbut-3-en-2-one;propan-2-one has a molecular weight of 365.52 g/mol, XLogP of 5.41, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-[4-[3-(5-ethyl-2-pyridinyl)propyl]phenyl]-3-methylbut-3-en-2-one;propan-2-one is sourced from PubChem (CID 142872927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).