C20H18N4O — CID 89318821
N-[3-[1-(2-methyliminohydrazinyl)ethenyl]phenyl]naphthalene-2-carboxamide (PubChem CID 89318821) has the molecular formula C20H18N4O and a molecular weight of 330.39 g/mol. Its IUPAC name is N-[3-[1-(2-methyliminohydrazinyl)ethenyl]phenyl]naphthalene-2-carboxamide.
| Compound Name | N-[3-[1-(2-methyliminohydrazinyl)ethenyl]phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 89318821 |
| Molecular Formula | C20H18N4O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N-[3-[1-(2-methyliminohydrazinyl)ethenyl]phenyl]naphthalene-2-carboxamide |
| SMILES | C=C(N/N=N/C)c1cccc(NC(=O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C20H18N4O/c1-14(23-24-21-2)16-8-5-9-19(13-16)22-20(25)18-11-10-15-6-3-4-7-17(15)12-18/h3-13H,1H2,2H3,(H,21,23)(H,22,25) |
| InChIKey | LDYYDAGGEJFQMF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|