C23H24F3N3O3 — CID 89319443
5-amino-N-[[1-(hydroxymethyl)cyclobutyl]methyl]-1-[[3-(trifluoromethoxy)phenyl]methyl]indole-2-carboxamide (PubChem CID 89319443) has the molecular formula C23H24F3N3O3 and a molecular weight of 447.46 g/mol. Its IUPAC name is 5-amino-N-[[1-(hydroxymethyl)cyclobutyl]methyl]-1-[[3-(trifluoromethoxy)phenyl]methyl]indole-2-carboxamide.
| Compound Name | 5-amino-N-[[1-(hydroxymethyl)cyclobutyl]methyl]-1-[[3-(trifluoromethoxy)phenyl]methyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 89319443 |
| Molecular Formula | C23H24F3N3O3 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 5-amino-N-[[1-(hydroxymethyl)cyclobutyl]methyl]-1-[[3-(trifluoromethoxy)phenyl]methyl]indole-2-carboxamide |
| SMILES | Nc1ccc2c(c1)cc(C(=O)NCC1(CO)CCC1)n2Cc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C23H24F3N3O3/c24-23(25,26)32-18-4-1-3-15(9-18)12-29-19-6-5-17(27)10-16(19)11-20(29)21(31)28-13-22(14-30)7-2-8-22/h1,3-6,9-11,30H,2,7-8,12-14,27H2,(H,28,31) |
| InChIKey | PJXDUHSPESRSFO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|